Products 441765-97-5
CAS 441765-97-5 is the registry number for Talaglumetad (hydrochloride), 99.58%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg, 10 mg.
(1S,2S,5R,6S)-2-[[(2S)-2-aminopropanoyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride (CAS 441765-97-5) is a chemical compound with the molecular formula C11H17ClN2O5 and a molecular weight of 292.71 g/mol. IUPAC name: (1S,2S,5R,6S)-2-[[(2S)-2-aminopropanoyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride. InChIKey: TWZDLCLCMKMJPE-OAOSNHGPSA-N.
| Molecular formula | C11H17ClN2O5 |
|---|---|
| Molecular weight | 292.71 g/mol |
| IUPAC name | (1S,2S,5R,6S)-2-[[(2S)-2-aminopropanoyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride |
| InChIKey | TWZDLCLCMKMJPE-OAOSNHGPSA-N |
| SMILES | C[C@@H](C(=O)N[C@]1(CC[C@@H]2[C@H]1[C@H]2C(=O)O)C(=O)O)N.Cl |
Computed by PubChem (NCBI)