CAS 441797-83-7 is the registry number for Macitentan Impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-bromophenyl)-6-chloro-N-(ethylsulfamoyl)pyrimidin-4-amine (CAS 441797-83-7) is a chemical compound with the molecular formula C12H12BrClN4O2S and a molecular weight of 391.67 g/mol. IUPAC name: 5-(4-bromophenyl)-6-chloro-N-(ethylsulfamoyl)pyrimidin-4-amine. InChIKey: LCQWUVFBXGNEBT-UHFFFAOYSA-N.
| Molecular formula | C12H12BrClN4O2S |
|---|---|
| Molecular weight | 391.67 g/mol |
| IUPAC name | 5-(4-bromophenyl)-6-chloro-N-(ethylsulfamoyl)pyrimidin-4-amine |
| InChIKey | LCQWUVFBXGNEBT-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)NC1=C(C(=NC=N1)Cl)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)