CAS 4418-73-9 is the registry number for Adonixanthin. Offered by: TRC. Available pack sizes: 25mg.
Adonixanthin is a carotenone that consists of beta,beta-caroten-4-one bearing two hydroxy substituents at positions 3 and 3' (the 3S,3'R diastereomer). It has a role as an antineoplastic agent, an animal metabolite, a marine metabolite, a plant metabolite, a bacterial metabolite and an algal metabolite. It is a carotenone, a secondary alcohol and a cyclic ketone.
Source: ChEBI
| Molecular formula | C40H54O3 |
|---|---|
| Molecular weight | 582.9 g/mol |
| IUPAC name | (6S)-6-hydroxy-3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,4,4-trimethylcyclohex-2-en-1-one |
| InChIKey | YECXHLPYMXGEBI-ZNQVSPAOSA-N |
| SMILES | CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C2=C(C(=O)[C@H](CC2(C)C)O)C)/C)/C |
Computed by PubChem (NCBI)