Products 442150-41-6
CAS 442150-41-6 is the registry number for CSV0C018875. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
6-chloro-N-(4-ethoxyphenyl)-2-methylquinolin-4-amine (CAS 442150-41-6) is a chemical compound with the molecular formula C18H17ClN2O and a molecular weight of 312.8 g/mol. IUPAC name: 6-chloro-N-(4-ethoxyphenyl)-2-methylquinolin-4-amine. InChIKey: NQNAQPVPGUVZAF-UHFFFAOYSA-N.
| Molecular formula | C18H17ClN2O |
|---|---|
| Molecular weight | 312.8 g/mol |
| IUPAC name | 6-chloro-N-(4-ethoxyphenyl)-2-methylquinolin-4-amine |
| InChIKey | NQNAQPVPGUVZAF-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)NC2=C3C=C(C=CC3=NC(=C2)C)Cl |
Computed by PubChem (NCBI)