CAS 4422-95-1 appears in our catalog under these names: 1,3,5–Benzenetricarbonyl trichloride, 1,3,5-Benzenetricarbonyl chloride, 98+% , Trimesoyl chloride, 1,3,5-Benzenetricarbonyl Trichloride, >98.0%(GC)(T), 1,3,5-Benzenetricarboxylic acid chloride, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Thermo Scientific (Acros). Available pack sizes: 100g, 250g, 25g, 500g, 5g, 1kg, 0,5kg, 10g.
Benzene-1,3,5-tricarbonyl chloride (CAS 4422-95-1) is a chemical compound with the molecular formula C9H3Cl3O3 and a molecular weight of 265.5 g/mol. IUPAC name: benzene-1,3,5-tricarbonyl chloride. InChIKey: UWCPYKQBIPYOLX-UHFFFAOYSA-N.
| Molecular formula | C9H3Cl3O3 |
|---|---|
| Molecular weight | 265.5 g/mol |
| IUPAC name | benzene-1,3,5-tricarbonyl chloride |
| InChIKey | UWCPYKQBIPYOLX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)Cl)C(=O)Cl)C(=O)Cl |
Computed by PubChem (NCBI)