CAS 4424-03-7 appears in our catalog under these names: 3',6'-dihydroxyspiro[2,1$l^{6}-benzoxathiole-3,9'-xanthene]-1,1-dione, 95%, Sulfonfluorescein, >75.0%(HPLC)(T), Sulfonfluorescein, 75%, 75%, 3',6'-Dihydroxyspiro[benzo[c][1,2]oxathiole-3,9'-xanthene] 1,1-dioxide, 75%. Offered by: Combi-blocks, TCI, Chemat, Ambeed. Available pack sizes: 5g, 1g, 10g, 25g.
1,1-dioxospiro[2,1lambda6-benzoxathiole-3,9'-xanthene]-3',6'-diol (CAS 4424-03-7) is a chemical compound with the molecular formula C19H12O6S and a molecular weight of 368.4 g/mol. IUPAC name: 1,1-dioxospiro[2,1lambda6-benzoxathiole-3,9'-xanthene]-3',6'-diol. InChIKey: VJYGFSGAAOVTLC-UHFFFAOYSA-N.
| Molecular formula | C19H12O6S |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 1,1-dioxospiro[2,1lambda6-benzoxathiole-3,9'-xanthene]-3',6'-diol |
| InChIKey | VJYGFSGAAOVTLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OS2(=O)=O |
Computed by PubChem (NCBI)