CAS 442514-48-9 appears in our catalog under these names: 2-(3',5'-Bis(trifluoromethyl)-[1,1'-biphenyl]-4-yl)acetonitrile, 95%, 95%, 2-(3',5'-Bis(trifluoromethyl)-[1,1'-biphenyl]-4-yl)acetonitrile, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]acetonitrile (CAS 442514-48-9) is a chemical compound with the molecular formula C16H9F6N and a molecular weight of 329.24 g/mol. IUPAC name: 2-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]acetonitrile. InChIKey: JWCPHNMWSQPBEK-UHFFFAOYSA-N.
| Molecular formula | C16H9F6N |
|---|---|
| Molecular weight | 329.24 g/mol |
| IUPAC name | 2-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]acetonitrile |
| InChIKey | JWCPHNMWSQPBEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC#N)C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)