CAS 442534-83-0 is the registry number for FGFR1 inhibitor-14. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]benzoic acid (CAS 442534-83-0) is a chemical compound with the molecular formula C18H12N2O5S and a molecular weight of 368.4 g/mol. IUPAC name: 2-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]benzoic acid. InChIKey: TYNXIZLQXIBWGQ-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O5S |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 2-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]benzoic acid |
| InChIKey | TYNXIZLQXIBWGQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NS(=O)(=O)C2=C3C=CC=C4C3=C(C=C2)NC4=O |
Computed by PubChem (NCBI)