Products 442549-60-2

CAS 442549-60-2 is the registry number for Methyl 8-bromo-6-fluoro-4-methoxyquinoline-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 8-bromo-6-fluoro-4-methoxyquinoline-2-carboxylate (CAS 442549-60-2) is a chemical compound with the molecular formula C12H9BrFNO3 and a molecular weight of 314.11 g/mol. IUPAC name: methyl 8-bromo-6-fluoro-4-methoxyquinoline-2-carboxylate. InChIKey: AQDMZIQDJNENRB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9BrFNO3
Molecular weight314.11 g/mol
IUPAC namemethyl 8-bromo-6-fluoro-4-methoxyquinoline-2-carboxylate
InChIKeyAQDMZIQDJNENRB-UHFFFAOYSA-N
SMILESCOC1=CC(=NC2=C1C=C(C=C2Br)F)C(=O)OC

Computed by PubChem (NCBI)