CAS 4429-47-4 appears in our catalog under these names: 2,5-Anhydro-D-glucitol 1,6-diphosphate, 97%, 2,5-Anhydro-D-Glucitol-1,6-Diphosphate, 2,5-Anhydro-D-glucitol-1,6-diphosphate, >95% (HPLC), 2,5-Anhydro-D-glucitol-1,6-diphosphate, 99.49%. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 2mg, 25mg, 5 mg, 1 mg.
[(2R,3S,4S,5S)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]methyl dihydrogen phosphate (CAS 4429-47-4) is a chemical compound with the molecular formula C6H14O11P2 and a molecular weight of 324.12 g/mol. IUPAC name: [(2R,3S,4S,5S)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]methyl dihydrogen phosphate. InChIKey: WSMBXSQDFPTODV-JGWLITMVSA-N.
| Molecular formula | C6H14O11P2 |
|---|---|
| Molecular weight | 324.12 g/mol |
| IUPAC name | [(2R,3S,4S,5S)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]methyl dihydrogen phosphate |
| InChIKey | WSMBXSQDFPTODV-JGWLITMVSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@@H](O1)COP(=O)(O)O)O)O)OP(=O)(O)O |
Computed by PubChem (NCBI)