CAS 442908-10-3 appears in our catalog under these names: Vipadenant, Vipadenant, 95%, Vipadenant/ 98%, Vipadenant 98%, Vipadenant, 98%, 98%. Offered by: GLPBio, Combi-blocks, TargetMol, Ambeed, Chemat. Available pack sizes: 10mg, 250mg, 1g, 1mg, 2mg, 5mg, 25mg, 50mg.
3-[(4-amino-3-methylphenyl)methyl]-7-(furan-2-yl)triazolo[4,5-d]pyrimidin-5-amine (CAS 442908-10-3) is a chemical compound with the molecular formula C16H15N7O and a molecular weight of 321.34 g/mol. IUPAC name: 3-[(4-amino-3-methylphenyl)methyl]-7-(furan-2-yl)triazolo[4,5-d]pyrimidin-5-amine. InChIKey: HQSBCDPYXDGTCL-UHFFFAOYSA-N.
| Molecular formula | C16H15N7O |
|---|---|
| Molecular weight | 321.34 g/mol |
| IUPAC name | 3-[(4-amino-3-methylphenyl)methyl]-7-(furan-2-yl)triazolo[4,5-d]pyrimidin-5-amine |
| InChIKey | HQSBCDPYXDGTCL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CN2C3=NC(=NC(=C3N=N2)C4=CC=CO4)N)N |
Computed by PubChem (NCBI)