CAS 442912-79-0 is the registry number for MIL–53(Cr). Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Chromium(3+);terephthalate;hydroxide (CAS 442912-79-0) is a chemical compound with the molecular formula C8H5CrO5 and a molecular weight of 233.12 g/mol. IUPAC name: chromium(3+);terephthalate;hydroxide. InChIKey: IHUWNIOMPKPEBO-UHFFFAOYSA-K.
| Molecular formula | C8H5CrO5 |
|---|---|
| Molecular weight | 233.12 g/mol |
| IUPAC name | chromium(3+);terephthalate;hydroxide |
| InChIKey | IHUWNIOMPKPEBO-UHFFFAOYSA-K |
| SMILES | C1=CC(=CC=C1C(=O)[O-])C(=O)[O-].[OH-].[Cr+3] |
Computed by PubChem (NCBI)