CAS 4430-20-0 appears in our catalog under these names: Chlorophenol Red , Chlorophenol Red, >90.0%(HPLC), Chlorophenol red, Chlorophenol Red, pure, indicator grade, Chlorophenol Red, 90.00%. Offered by: Thermo Scientific (Alfa Aesar), TCI, Biosynth, Thermo Scientific (Acros), Chemat. Available pack sizes: 5g, 25g, 1g, 250g, 100g, 10g, 50g, 500g.
2-chloro-4-[3-(3-chloro-4-hydroxyphenyl)-1,1-dioxo-2,1lambda6-benzoxathiol-3-yl]phenol (CAS 4430-20-0) is a chemical compound with the molecular formula C19H12Cl2O5S and a molecular weight of 423.3 g/mol. IUPAC name: 2-chloro-4-[3-(3-chloro-4-hydroxyphenyl)-1,1-dioxo-2,1lambda6-benzoxathiol-3-yl]phenol. InChIKey: WWAABJGNHFGXSJ-UHFFFAOYSA-N.
| Molecular formula | C19H12Cl2O5S |
|---|---|
| Molecular weight | 423.3 g/mol |
| IUPAC name | 2-chloro-4-[3-(3-chloro-4-hydroxyphenyl)-1,1-dioxo-2,1lambda6-benzoxathiol-3-yl]phenol |
| InChIKey | WWAABJGNHFGXSJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C=C3)O)Cl)C4=CC(=C(C=C4)O)Cl |
Computed by PubChem (NCBI)