CAS 443147-52-2 is the registry number for 2-Chloro-4-thiophen-2-yl-thieno[3,2-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-4-thiophen-2-ylthieno[3,2-d]pyrimidine (CAS 443147-52-2) is a chemical compound with the molecular formula C10H5ClN2S2 and a molecular weight of 252.7 g/mol. IUPAC name: 2-chloro-4-thiophen-2-ylthieno[3,2-d]pyrimidine. InChIKey: GFDPXLUZWJSHBL-UHFFFAOYSA-N.
| Molecular formula | C10H5ClN2S2 |
|---|---|
| Molecular weight | 252.7 g/mol |
| IUPAC name | 2-chloro-4-thiophen-2-ylthieno[3,2-d]pyrimidine |
| InChIKey | GFDPXLUZWJSHBL-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC(=NC3=C2SC=C3)Cl |
Computed by PubChem (NCBI)