Products 4432-44-4

CAS 4432-44-4 appears in our catalog under these names: 2-(Morpholinomethyl)acrylic acid, 95%, 2-(Morpholinomethyl)acrylic acid 97%, 2-(MORPHOLINOMETHYL)ACRYLIC ACID, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

2-(morpholin-4-ylmethyl)prop-2-enoic acid (CAS 4432-44-4) is a chemical compound with the molecular formula C8H13NO3 and a molecular weight of 171.19 g/mol. IUPAC name: 2-(morpholin-4-ylmethyl)prop-2-enoic acid. InChIKey: IGZSSKAOSOCVPH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13NO3
Molecular weight171.19 g/mol
IUPAC name2-(morpholin-4-ylmethyl)prop-2-enoic acid
InChIKeyIGZSSKAOSOCVPH-UHFFFAOYSA-N
SMILESC=C(CN1CCOCC1)C(=O)O

Computed by PubChem (NCBI)