Products 443289-92-7

CAS 443289-92-7 is the registry number for 4-((5-Bromo-2-ethoxy-4-formylphenoxy)methyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[(5-bromo-2-ethoxy-4-formylphenoxy)methyl]benzoic acid (CAS 443289-92-7) is a chemical compound with the molecular formula C17H15BrO5 and a molecular weight of 379.2 g/mol. IUPAC name: 4-[(5-bromo-2-ethoxy-4-formylphenoxy)methyl]benzoic acid. InChIKey: DOSJDBAABQLLCQ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15BrO5
Molecular weight379.2 g/mol
IUPAC name4-[(5-bromo-2-ethoxy-4-formylphenoxy)methyl]benzoic acid
InChIKeyDOSJDBAABQLLCQ-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C(=C1)C=O)Br)OCC2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)