CAS 443638-58-2 is the registry number for 2-Fluoro-N-(3-iodophenyl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-N-(3-iodophenyl)benzamide (CAS 443638-58-2) is a chemical compound with the molecular formula C13H9FINO and a molecular weight of 341.12 g/mol. IUPAC name: 2-fluoro-N-(3-iodophenyl)benzamide. InChIKey: TUCVMQOPHNUVKW-UHFFFAOYSA-N.
| Molecular formula | C13H9FINO |
|---|---|
| Molecular weight | 341.12 g/mol |
| IUPAC name | 2-fluoro-N-(3-iodophenyl)benzamide |
| InChIKey | TUCVMQOPHNUVKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC(=CC=C2)I)F |
Computed by PubChem (NCBI)