CAS 443798-47-8 appears in our catalog under these names: K00546, 97%, Cdk1/2 Inhibitor III, Cdk1/2 Inhibitor III, K00546 95%, 5-Amino-N-(2,6-difluorophenyl)-3-((4-sulfamoylphenyl)amino)-1H-1,2,4-triazole-1-carbothioamide. Offered by: AmBeed, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 25mg, 10mg, 10mM 1ml in dmso, 5mg, 50mg, 2mg, 50 mg.
5-amino-N-(2,6-difluorophenyl)-3-(4-sulfamoylanilino)-1,2,4-triazole-1-carbothioamide (CAS 443798-47-8) is a chemical compound with the molecular formula C15H13F2N7O2S2 and a molecular weight of 425.4 g/mol. IUPAC name: 5-amino-N-(2,6-difluorophenyl)-3-(4-sulfamoylanilino)-1,2,4-triazole-1-carbothioamide. InChIKey: ARIOBGGRZJITQX-UHFFFAOYSA-N.
| Molecular formula | C15H13F2N7O2S2 |
|---|---|
| Molecular weight | 425.4 g/mol |
| IUPAC name | 5-amino-N-(2,6-difluorophenyl)-3-(4-sulfamoylanilino)-1,2,4-triazole-1-carbothioamide |
| InChIKey | ARIOBGGRZJITQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)NC(=S)N2C(=NC(=N2)NC3=CC=C(C=C3)S(=O)(=O)N)N)F |
Computed by PubChem (NCBI)