CAS 443883-90-7 is the registry number for 5-(5-Bromo-furan-2-ylmethylene)-2-thioxo-dihydro-pyrimidine-4,6-dione. Offered by: Biosynth. Available pack sizes: 0,25g, 0,5g.
5-[(5-bromofuran-2-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (CAS 443883-90-7) is a chemical compound with the molecular formula C9H5BrN2O3S and a molecular weight of 301.12 g/mol. IUPAC name: 5-[(5-bromofuran-2-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione. InChIKey: YRSNXZKTMFUIKR-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O3S |
|---|---|
| Molecular weight | 301.12 g/mol |
| IUPAC name | 5-[(5-bromofuran-2-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| InChIKey | YRSNXZKTMFUIKR-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)Br)C=C2C(=O)NC(=S)NC2=O |
Computed by PubChem (NCBI)