Products 443912-82-1

CAS 443912-82-1 is the registry number for 1H-Pyrazole-5-acetic acid, 3-(1,1-dimethylethyl)-1-phenyl-, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-tert-butyl-1-phenylpyrazol-5-yl)acetic acid (CAS 443912-82-1) is a chemical compound with the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. IUPAC name: 2-(3-tert-butyl-1-phenylpyrazol-5-yl)acetic acid. InChIKey: LGFWUKKBQVHRIN-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18N2O2
Molecular weight258.32 g/mol
IUPAC name2-(3-tert-butyl-1-phenylpyrazol-5-yl)acetic acid
InChIKeyLGFWUKKBQVHRIN-UHFFFAOYSA-N
SMILESCC(C)(C)C1=NN(C(=C1)CC(=O)O)C2=CC=CC=C2

Computed by PubChem (NCBI)