Products 443915-54-6
CAS 443915-54-6 is the registry number for 1-Cyclopentyl-4-(4-nitrophenyl)piperazine, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1-cyclopentyl-4-(4-nitrophenyl)piperazine (CAS 443915-54-6) is a chemical compound with the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. IUPAC name: 1-cyclopentyl-4-(4-nitrophenyl)piperazine. InChIKey: BPQLMOSHJDBMDQ-UHFFFAOYSA-N.
| Molecular formula | C15H21N3O2 |
|---|---|
| Molecular weight | 275.35 g/mol |
| IUPAC name | 1-cyclopentyl-4-(4-nitrophenyl)piperazine |
| InChIKey | BPQLMOSHJDBMDQ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2CCN(CC2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)