CAS 443989-01-3 is the registry number for GSI-136. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-chloro-N-[(2S)-3-ethyl-1-hydroxypentan-2-yl]thiophene-2-sulfonamide (CAS 443989-01-3) is a chemical compound with the molecular formula C11H18ClNO3S2 and a molecular weight of 311.9 g/mol. IUPAC name: 5-chloro-N-[(2S)-3-ethyl-1-hydroxypentan-2-yl]thiophene-2-sulfonamide. InChIKey: PYZFRRVBPNGCBX-SECBINFHSA-N.
| Molecular formula | C11H18ClNO3S2 |
|---|---|
| Molecular weight | 311.9 g/mol |
| IUPAC name | 5-chloro-N-[(2S)-3-ethyl-1-hydroxypentan-2-yl]thiophene-2-sulfonamide |
| InChIKey | PYZFRRVBPNGCBX-SECBINFHSA-N |
| SMILES | CCC(CC)[C@@H](CO)NS(=O)(=O)C1=CC=C(S1)Cl |
Computed by PubChem (NCBI)