Products 443990-97-4

CAS 443990-97-4 is the registry number for 5-Chlorofuran-2-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-chlorofuran-2-sulfonyl chloride (CAS 443990-97-4) is a chemical compound with the molecular formula C4H2Cl2O3S and a molecular weight of 201.03 g/mol. IUPAC name: 5-chlorofuran-2-sulfonyl chloride. InChIKey: SEHRKLAFSBAINR-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2Cl2O3S
Molecular weight201.03 g/mol
IUPAC name5-chlorofuran-2-sulfonyl chloride
InChIKeySEHRKLAFSBAINR-UHFFFAOYSA-N
SMILESC1=C(OC(=C1)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)