CAS 443990-97-4 is the registry number for 5-Chlorofuran-2-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-chlorofuran-2-sulfonyl chloride (CAS 443990-97-4) is a chemical compound with the molecular formula C4H2Cl2O3S and a molecular weight of 201.03 g/mol. IUPAC name: 5-chlorofuran-2-sulfonyl chloride. InChIKey: SEHRKLAFSBAINR-UHFFFAOYSA-N.
| Molecular formula | C4H2Cl2O3S |
|---|---|
| Molecular weight | 201.03 g/mol |
| IUPAC name | 5-chlorofuran-2-sulfonyl chloride |
| InChIKey | SEHRKLAFSBAINR-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)