Products 4440-40-8

CAS 4440-40-8 is the registry number for Cyclohepta-2,4,6-triene-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

Cyclohepta-2,4,6-triene-1-carboxylic acid (CAS 4440-40-8) is a chemical compound with the molecular formula C8H8O2 and a molecular weight of 136.15 g/mol. IUPAC name: cyclohepta-2,4,6-triene-1-carboxylic acid. InChIKey: MMJMJYGSJNZKBB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8O2
Molecular weight136.15 g/mol
IUPAC namecyclohepta-2,4,6-triene-1-carboxylic acid
InChIKeyMMJMJYGSJNZKBB-UHFFFAOYSA-N
SMILESC1=CC=CC(C=C1)C(=O)O

Computed by PubChem (NCBI)