Products 444088-20-4
CAS 444088-20-4 is the registry number for PD-217014-methyl ester. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 2-[(1R,5S)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetate (CAS 444088-20-4) is a chemical compound with the molecular formula C11H19NO2 and a molecular weight of 197.27 g/mol. IUPAC name: methyl 2-[(1R,5S)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetate. InChIKey: ASBDKEXHKWHAPE-SLHIUPAKSA-N.
| Molecular formula | C11H19NO2 |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | methyl 2-[(1R,5S)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetate |
| InChIKey | ASBDKEXHKWHAPE-SLHIUPAKSA-N |
| SMILES | COC(=O)CC1(C[C@H]2CC[C@H]2C1)CN |
Computed by PubChem (NCBI)