CAS 444110-64-9 appears in our catalog under these names: 2-Ethoxy-4-formylphenyl 2,4-dichlorobenzoate, 95%, 2-ethoxy-4-formylphenyl 2,4-dichlorobenzoate, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g.
(2-ethoxy-4-formylphenyl) 2,4-dichlorobenzoate (CAS 444110-64-9) is a chemical compound with the molecular formula C16H12Cl2O4 and a molecular weight of 339.2 g/mol. IUPAC name: (2-ethoxy-4-formylphenyl) 2,4-dichlorobenzoate. InChIKey: YSIHJPBCURKXBS-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2O4 |
|---|---|
| Molecular weight | 339.2 g/mol |
| IUPAC name | (2-ethoxy-4-formylphenyl) 2,4-dichlorobenzoate |
| InChIKey | YSIHJPBCURKXBS-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C=O)OC(=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)