CAS 444143-45-7 is the registry number for 4-Amino-3',5'-bis(trifluoromethyl)biphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-[3,5-bis(trifluoromethyl)phenyl]aniline (CAS 444143-45-7) is a chemical compound with the molecular formula C14H9F6N and a molecular weight of 305.22 g/mol. IUPAC name: 4-[3,5-bis(trifluoromethyl)phenyl]aniline. InChIKey: MGGUROGTKGUOGP-UHFFFAOYSA-N.
| Molecular formula | C14H9F6N |
|---|---|
| Molecular weight | 305.22 g/mol |
| IUPAC name | 4-[3,5-bis(trifluoromethyl)phenyl]aniline |
| InChIKey | MGGUROGTKGUOGP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)N |
Computed by PubChem (NCBI)