Products 444145-79-3

CAS 444145-79-3 is the registry number for 2-((4-(N-Mesitylsulfamoyl)phenyl)carbamoyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid (CAS 444145-79-3) is a chemical compound with the molecular formula C23H22N2O5S and a molecular weight of 438.5 g/mol. IUPAC name: 2-[[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid. InChIKey: CDORHVLQFWYBJB-UHFFFAOYSA-N.

Identity
Molecular formulaC23H22N2O5S
Molecular weight438.5 g/mol
IUPAC name2-[[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid
InChIKeyCDORHVLQFWYBJB-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)C)NS(=O)(=O)C2=CC=C(C=C2)NC(=O)C3=CC=CC=C3C(=O)O)C

Computed by PubChem (NCBI)