CAS 444145-79-3 is the registry number for 2-((4-(N-Mesitylsulfamoyl)phenyl)carbamoyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid (CAS 444145-79-3) is a chemical compound with the molecular formula C23H22N2O5S and a molecular weight of 438.5 g/mol. IUPAC name: 2-[[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid. InChIKey: CDORHVLQFWYBJB-UHFFFAOYSA-N.
| Molecular formula | C23H22N2O5S |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | 2-[[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid |
| InChIKey | CDORHVLQFWYBJB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NS(=O)(=O)C2=CC=C(C=C2)NC(=O)C3=CC=CC=C3C(=O)O)C |
Computed by PubChem (NCBI)