CAS 444289-05-8 appears in our catalog under these names: Lenalidomide-4-aminomethyl HCl 97%, 3-(4-(Aminomethyl)-1-oxoisoindolin-2-yl)piperidine-2,6-dione hydrochloride, 97%, 97%, Lenalidomide-4-aminomethyl (hydrochloride), 90.88%, 3-(4-(Aminomethyl)-1-oxoisoindolin-2-yl)piperidine-2,6-dione hydrochloride, 97%. Offered by: Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 50 mg, 10 mg, 5 mg, 100 mg.
3-[7-(aminomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride (CAS 444289-05-8) is a chemical compound with the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. IUPAC name: 3-[7-(aminomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride. InChIKey: VOUMCDUUDATPTJ-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN3O3 |
|---|---|
| Molecular weight | 309.75 g/mol |
| IUPAC name | 3-[7-(aminomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride |
| InChIKey | VOUMCDUUDATPTJ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C=CC=C3C2=O)CN.Cl |
Computed by PubChem (NCBI)