CAS 4444-26-2 appears in our catalog under these names: 1,2,3,4,5,6-Benzenehexamine, Hexaaminobenzene trihydrochloride, 1,2,3,4,5,6-Benzenehexamine 97%, Hexaaminobenzene, 97%, 97%. Offered by: TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 10mg, 1g, 50mg, 25mg.
Benzene-1,2,3,4,5,6-hexamine (CAS 4444-26-2) is a chemical compound with the molecular formula C6H12N6 and a molecular weight of 168.20 g/mol. IUPAC name: benzene-1,2,3,4,5,6-hexamine. InChIKey: OWSZUKMVEBFJMZ-UHFFFAOYSA-N.
| Molecular formula | C6H12N6 |
|---|---|
| Molecular weight | 168.20 g/mol |
| IUPAC name | benzene-1,2,3,4,5,6-hexamine |
| InChIKey | OWSZUKMVEBFJMZ-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1N)N)N)N)N)N |
Computed by PubChem (NCBI)