Products 444579-59-3
CAS 444579-59-3 is the registry number for Indisulam analog-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-N-(3-cyano-1H-indol-7-yl)benzene-1,4-disulfonamide (CAS 444579-59-3) is a chemical compound with the molecular formula C15H12N4O4S2 and a molecular weight of 376.4 g/mol. IUPAC name: 4-N-(3-cyano-1H-indol-7-yl)benzene-1,4-disulfonamide. InChIKey: RSFHGWJANOTWJM-UHFFFAOYSA-N.
| Molecular formula | C15H12N4O4S2 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | 4-N-(3-cyano-1H-indol-7-yl)benzene-1,4-disulfonamide |
| InChIKey | RSFHGWJANOTWJM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)NS(=O)(=O)C3=CC=C(C=C3)S(=O)(=O)N)NC=C2C#N |
Computed by PubChem (NCBI)