Products 444587-02-4
CAS 444587-02-4 is the registry number for (1E)-2-(4-CHLOROPHENYL)-N,N-DIMETHYLETHENAMINE, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(E)-2-(4-chlorophenyl)-N,N-dimethylethenamine (CAS 444587-02-4) is a chemical compound with the molecular formula C10H12ClN and a molecular weight of 181.66 g/mol. IUPAC name: (E)-2-(4-chlorophenyl)-N,N-dimethylethenamine. InChIKey: GTWSEYQKBWXICU-BQYQJAHWSA-N.
| Molecular formula | C10H12ClN |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (E)-2-(4-chlorophenyl)-N,N-dimethylethenamine |
| InChIKey | GTWSEYQKBWXICU-BQYQJAHWSA-N |
| SMILES | CN(C)/C=C/C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)