CAS 444722-95-6 appears in our catalog under these names: NU6102, NU6102/ 99.58% (existing batch purity), NU 6102, Cdk1/2 Inhibitor II, NU6102, NU6102 98%. Offered by: TRC, TargetMol, GLPBio, Chemat, Biosynth. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 1mg, 200mg.
4-[[6-(cyclohexylmethoxy)-7H-purin-2-yl]amino]benzenesulfonamide (CAS 444722-95-6) is a chemical compound with the molecular formula C18H22N6O3S and a molecular weight of 402.5 g/mol. IUPAC name: 4-[[6-(cyclohexylmethoxy)-7H-purin-2-yl]amino]benzenesulfonamide. InChIKey: OWXORKPNCHJYOF-UHFFFAOYSA-N.
| Molecular formula | C18H22N6O3S |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | 4-[[6-(cyclohexylmethoxy)-7H-purin-2-yl]amino]benzenesulfonamide |
| InChIKey | OWXORKPNCHJYOF-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)COC2=NC(=NC3=C2NC=N3)NC4=CC=C(C=C4)S(=O)(=O)N |
Computed by PubChem (NCBI)