CAS 444790-64-1 appears in our catalog under these names: (4-Chlorophenyl)(5-hydroxynaphtho[1,2-b]furan-3-yl)methanone, 98%, COX-2-IN-40. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
(4-chlorophenyl)-(5-hydroxybenzo[g][1]benzofuran-3-yl)methanone (CAS 444790-64-1) is a chemical compound with the molecular formula C19H11ClO3 and a molecular weight of 322.7 g/mol. IUPAC name: (4-chlorophenyl)-(5-hydroxybenzo[g][1]benzofuran-3-yl)methanone. InChIKey: DHFMPIJITCFEFT-UHFFFAOYSA-N.
| Molecular formula | C19H11ClO3 |
|---|---|
| Molecular weight | 322.7 g/mol |
| IUPAC name | (4-chlorophenyl)-(5-hydroxybenzo[g][1]benzofuran-3-yl)methanone |
| InChIKey | DHFMPIJITCFEFT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC3=C2OC=C3C(=O)C4=CC=C(C=C4)Cl)O |
Computed by PubChem (NCBI)