CAS 444815-10-5 is the registry number for N-tert-Butoxycarbonyl-N-(3-cyanophenyl)aniline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
Tert-butyl N-(3-cyanophenyl)-N-phenylcarbamate (CAS 444815-10-5) is a chemical compound with the molecular formula C18H18N2O2 and a molecular weight of 294.3 g/mol. IUPAC name: tert-butyl N-(3-cyanophenyl)-N-phenylcarbamate. InChIKey: KGMALNJAOCQMSK-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O2 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | tert-butyl N-(3-cyanophenyl)-N-phenylcarbamate |
| InChIKey | KGMALNJAOCQMSK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=CC=CC=C1)C2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)