CAS 444912-48-5 appears in our catalog under these names: AM1241, (2-Iodo-5-nitrophenyl)(1-((1-methyl-2-piperidinyl)methyl)-1H-indol-3-yl)methanone, AM1241/ 98.72% (existing batch purity), (R,S)-AM1241. Offered by: GLPBio, TRC, TargetMol, Sigma-Aldrich. Available pack sizes: 5mg, 250mg, 2mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(2-iodo-5-nitrophenyl)-[1-[(1-methylpiperidin-2-yl)methyl]indol-3-yl]methanone (CAS 444912-48-5) is a chemical compound with the molecular formula C22H22IN3O3 and a molecular weight of 503.3 g/mol. IUPAC name: (2-iodo-5-nitrophenyl)-[1-[(1-methylpiperidin-2-yl)methyl]indol-3-yl]methanone. InChIKey: ZUHIXXCLLBMBDW-UHFFFAOYSA-N.
| Molecular formula | C22H22IN3O3 |
|---|---|
| Molecular weight | 503.3 g/mol |
| IUPAC name | (2-iodo-5-nitrophenyl)-[1-[(1-methylpiperidin-2-yl)methyl]indol-3-yl]methanone |
| InChIKey | ZUHIXXCLLBMBDW-UHFFFAOYSA-N |
| SMILES | CN1CCCCC1CN2C=C(C3=CC=CC=C32)C(=O)C4=C(C=CC(=C4)[N+](=O)[O-])I |
Computed by PubChem (NCBI)