Products 445032-93-9

CAS 445032-93-9 is the registry number for Antiviral agent 78. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

6-bromo-2-(5-bromothiophen-2-yl)-3-methylquinoline-4-carboxylic acid (CAS 445032-93-9) is a chemical compound with the molecular formula C15H9Br2NO2S and a molecular weight of 427.1 g/mol. IUPAC name: 6-bromo-2-(5-bromothiophen-2-yl)-3-methylquinoline-4-carboxylic acid. InChIKey: GNQWNKAPUDRNHG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H9Br2NO2S
Molecular weight427.1 g/mol
IUPAC name6-bromo-2-(5-bromothiophen-2-yl)-3-methylquinoline-4-carboxylic acid
InChIKeyGNQWNKAPUDRNHG-UHFFFAOYSA-N
SMILESCC1=C(C2=C(C=CC(=C2)Br)N=C1C3=CC=C(S3)Br)C(=O)O

Computed by PubChem (NCBI)