CAS 445032-93-9 is the registry number for Antiviral agent 78. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-bromo-2-(5-bromothiophen-2-yl)-3-methylquinoline-4-carboxylic acid (CAS 445032-93-9) is a chemical compound with the molecular formula C15H9Br2NO2S and a molecular weight of 427.1 g/mol. IUPAC name: 6-bromo-2-(5-bromothiophen-2-yl)-3-methylquinoline-4-carboxylic acid. InChIKey: GNQWNKAPUDRNHG-UHFFFAOYSA-N.
| Molecular formula | C15H9Br2NO2S |
|---|---|
| Molecular weight | 427.1 g/mol |
| IUPAC name | 6-bromo-2-(5-bromothiophen-2-yl)-3-methylquinoline-4-carboxylic acid |
| InChIKey | GNQWNKAPUDRNHG-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=CC(=C2)Br)N=C1C3=CC=C(S3)Br)C(=O)O |
Computed by PubChem (NCBI)