CAS 4451-37-0 is the registry number for (2R,3R,4R,5R,6S)–2–(acetoxymethyl)–6–chloro–5–hydroxytetrahydro–2H–pyran–3,4–diyl diacetate. Offered by: GLPBio. Available pack sizes: 1g.
[(2R,3R,4R,5R,6S)-3,4-diacetyloxy-6-chloro-5-hydroxyoxan-2-yl]methyl acetate (CAS 4451-37-0) is a chemical compound with the molecular formula C12H17ClO8 and a molecular weight of 324.71 g/mol. IUPAC name: [(2R,3R,4R,5R,6S)-3,4-diacetyloxy-6-chloro-5-hydroxyoxan-2-yl]methyl acetate. InChIKey: WCYKMRJTYLWEET-LZQZFOIKSA-N.
| Molecular formula | C12H17ClO8 |
|---|---|
| Molecular weight | 324.71 g/mol |
| IUPAC name | [(2R,3R,4R,5R,6S)-3,4-diacetyloxy-6-chloro-5-hydroxyoxan-2-yl]methyl acetate |
| InChIKey | WCYKMRJTYLWEET-LZQZFOIKSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)Cl)O)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)