Products 445295-04-5
CAS 445295-04-5 appears in our catalog under these names: CP671305, Cp671305, 95%, CP671305/ 99.22% (existing batch purity), CP 671305, CP671305 99%. Offered by: GLPBio, Combi-blocks, TargetMol, Biosynth, Ambeed. Available pack sizes: 5mg, 250mg, 100mg, 1mg, 10mg, 25mg, 50mg, 20mg.
(2R)-2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenoxy]propanoic acid (CAS 445295-04-5) is a chemical compound with the molecular formula C23H19FN2O7 and a molecular weight of 454.4 g/mol. IUPAC name: (2R)-2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenoxy]propanoic acid. InChIKey: CNIGFESSDPOCKS-CYBMUJFWSA-N.
| Molecular formula | C23H19FN2O7 |
|---|---|
| Molecular weight | 454.4 g/mol |
| IUPAC name | (2R)-2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenoxy]propanoic acid |
| InChIKey | CNIGFESSDPOCKS-CYBMUJFWSA-N |
| SMILES | C[C@H](C(=O)O)OC1=CC(=C(C=C1)CNC(=O)C2=C(N=CC=C2)OC3=CC4=C(C=C3)OCO4)F |
Computed by PubChem (NCBI)