Products 445373-11-5

CAS 445373-11-5 is the registry number for 3,5-Dimethyl-2-(methylsulfanyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3,5-dimethyl-2-methylsulfanylpyridine (CAS 445373-11-5) is a chemical compound with the molecular formula C8H11NS and a molecular weight of 153.25 g/mol. IUPAC name: 3,5-dimethyl-2-methylsulfanylpyridine. InChIKey: KADHHBXYBPACIC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11NS
Molecular weight153.25 g/mol
IUPAC name3,5-dimethyl-2-methylsulfanylpyridine
InChIKeyKADHHBXYBPACIC-UHFFFAOYSA-N
SMILESCC1=CC(=C(N=C1)SC)C

Computed by PubChem (NCBI)