Products 4454-16-4
CAS 4454-16-4 is the registry number for Nickel(II) 2–ethylhexanoate, 78% in 2–ethylhexanoic acid (10–15% Ni). Offered by: GLPBio. Available pack sizes: 250g, 50g.
Bis(2-ethylhexanoate);nickel(2+) (CAS 4454-16-4) is a chemical compound with the molecular formula C16H30NiO4 and a molecular weight of 345.10 g/mol. IUPAC name: bis(2-ethylhexanoate);nickel(2+). InChIKey: UVPKUTPZWFHAHY-UHFFFAOYSA-L.
| Molecular formula | C16H30NiO4 |
|---|---|
| Molecular weight | 345.10 g/mol |
| IUPAC name | bis(2-ethylhexanoate);nickel(2+) |
| InChIKey | UVPKUTPZWFHAHY-UHFFFAOYSA-L |
| SMILES | CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Ni+2] |
Computed by PubChem (NCBI)
Synonyms:
Nickel bis(2-ethylhexanoate), Hexanoic acid, 2ethyl, nickel(2+) salt, Nickel(II) 2-ethylhexanoate, 2-ethylhexanoate;nickel(2+), Hexanoic acid, 2-ethyl-, nickel(2+) salt, Nickel(II) 2-ethylhexanoate, 78% in 2-ethylhexanoic acid (10-15% Ni), nickelous;2-ethylhexanoate, nickel bis(2-ethyl hexanoate), nickel(2+) bis(2-ethylhexanoate), nickel(II) bis (2-ethylhexanoate)