CAS 445418-34-8 is the registry number for 1-(3,5-bis(trifluoromethyl)phenyl)-3-(2-phenylacetyl)thiourea. Offered by: Biosynth. Available pack sizes: 250mg.
N-[[3,5-bis(trifluoromethyl)phenyl]carbamothioyl]-2-phenylacetamide (CAS 445418-34-8) is a chemical compound with the molecular formula C17H12F6N2OS and a molecular weight of 406.3 g/mol. IUPAC name: N-[[3,5-bis(trifluoromethyl)phenyl]carbamothioyl]-2-phenylacetamide. InChIKey: RPVQYGOJCWSQMX-UHFFFAOYSA-N.
| Molecular formula | C17H12F6N2OS |
|---|---|
| Molecular weight | 406.3 g/mol |
| IUPAC name | N-[[3,5-bis(trifluoromethyl)phenyl]carbamothioyl]-2-phenylacetamide |
| InChIKey | RPVQYGOJCWSQMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)NC(=S)NC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)