CAS 445473-58-5 appears in our catalog under these names: 1–Butyl–3–methylimidazolium octyl sulfate, 1-n-Butyl-3-methylimidazolium n-octyl sulfate, 99% , 1-BUTYL-3-METHYLIMIDAZOLIUM OCTYL SULFA&, 1-Butyl-3-methylimidazolium octylsulfate, 98%, 98%, 1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 500g, 5g, 50g, 1g.
1-butyl-3-methylimidazol-3-ium;octyl sulfate (CAS 445473-58-5) is a chemical compound with the molecular formula C16H32N2O4S and a molecular weight of 348.5 g/mol. IUPAC name: 1-butyl-3-methylimidazol-3-ium;octyl sulfate. InChIKey: KIDIBVPFLKLKAH-UHFFFAOYSA-M.
| Molecular formula | C16H32N2O4S |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | 1-butyl-3-methylimidazol-3-ium;octyl sulfate |
| InChIKey | KIDIBVPFLKLKAH-UHFFFAOYSA-M |
| SMILES | CCCCCCCCOS(=O)(=O)[O-].CCCCN1C=C[N+](=C1)C |
Computed by PubChem (NCBI)