Products 4463-03-0
CAS 4463-03-0 appears in our catalog under these names: 2,4,6-trimethylbenzene-1,3,5-triol, Phloroglucinol Impurity 69, Trimethylphloroglucinol, 2,4,6-Trimethylbenzene-1,3,5-triol, 97%, Trimethylphloroglucinol, >95% (HPLC). Offered by: Chemat Brand, AmBeed, TRC, Chemat, Fluorochem. Available pack sizes: on request, 5mg, 10mg, 50mg, 100mg, 250mg, 1g, 25mg.
2,4,6-trimethylbenzene-1,3,5-triol (CAS 4463-03-0) is a chemical compound with the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. IUPAC name: 2,4,6-trimethylbenzene-1,3,5-triol. InChIKey: MNBSXKSWDLYJHN-UHFFFAOYSA-N.
| Molecular formula | C9H12O3 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 2,4,6-trimethylbenzene-1,3,5-triol |
| InChIKey | MNBSXKSWDLYJHN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1O)C)O)C)O |
Computed by PubChem (NCBI)