CAS 4466-69-7 is the registry number for 5-(2,4-Dichlorophenyl)furan-2-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,4-dichlorophenyl)furan-2-carbonitrile (CAS 4466-69-7) is a chemical compound with the molecular formula C11H5Cl2NO and a molecular weight of 238.07 g/mol. IUPAC name: 5-(2,4-dichlorophenyl)furan-2-carbonitrile. InChIKey: MGSUONKUVHYCSU-UHFFFAOYSA-N.
| Molecular formula | C11H5Cl2NO |
|---|---|
| Molecular weight | 238.07 g/mol |
| IUPAC name | 5-(2,4-dichlorophenyl)furan-2-carbonitrile |
| InChIKey | MGSUONKUVHYCSU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=CC=C(O2)C#N |
Computed by PubChem (NCBI)