CAS 4468-72-8 appears in our catalog under these names: Phenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside, (2R,3R,4S,5R,6S)-2-(Acetoxymethyl)-6-phenoxytetrahydro-2H-pyran-3,4,5-triyl triacetate, 98%, 98%. Offered by: Biosynth, Chemat. Available pack sizes: 2g, 1g, 5g, 25g, 10g.
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-phenoxyoxan-2-yl]methyl acetate (CAS 4468-72-8) is a chemical compound with the molecular formula C20H24O10 and a molecular weight of 424.4 g/mol. IUPAC name: [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-phenoxyoxan-2-yl]methyl acetate. InChIKey: HPKPFIHCMIKXMU-OUUBHVDSSA-N.
| Molecular formula | C20H24O10 |
|---|---|
| Molecular weight | 424.4 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-phenoxyoxan-2-yl]methyl acetate |
| InChIKey | HPKPFIHCMIKXMU-OUUBHVDSSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC2=CC=CC=C2)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)