CAS 448-19-1 appears in our catalog under these names: 3-Fluoro-6-nitroanisole, 5–Fluoro–2–nitroanisole, 5-Fluoro-2-nitroanisole, 5-Fluoro-2-nitroanisole, >98.0%(GC), 5-Fluoro-2-nitroanisole 98%. Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 10g, 1g, 50g, 500g, 2kg, 5kg, 5g, 25g.
4-fluoro-2-methoxy-1-nitrobenzene (CAS 448-19-1) is a chemical compound with the molecular formula C7H6FNO3 and a molecular weight of 171.13 g/mol. IUPAC name: 4-fluoro-2-methoxy-1-nitrobenzene. InChIKey: WLKUSVNHZXUEFO-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO3 |
|---|---|
| Molecular weight | 171.13 g/mol |
| IUPAC name | 4-fluoro-2-methoxy-1-nitrobenzene |
| InChIKey | WLKUSVNHZXUEFO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)