CAS 448230-37-3 is the registry number for 2-(5-(Trifluoromethyl)pyridin-2-yl)-1,2,3,4-tetrahydrophthalazine-1,4-dione, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[5-(trifluoromethyl)-2-pyridinyl]-2H-phthalazine-1,4-dione (CAS 448230-37-3) is a chemical compound with the molecular formula C14H8F3N3O2 and a molecular weight of 307.23 g/mol. IUPAC name: 3-[5-(trifluoromethyl)-2-pyridinyl]-2H-phthalazine-1,4-dione. InChIKey: VPWISPUGLDMCRE-UHFFFAOYSA-N.
| Molecular formula | C14H8F3N3O2 |
|---|---|
| Molecular weight | 307.23 g/mol |
| IUPAC name | 3-[5-(trifluoromethyl)-2-pyridinyl]-2H-phthalazine-1,4-dione |
| InChIKey | VPWISPUGLDMCRE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NN(C2=O)C3=NC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)