Products 4486-44-6

CAS 4486-44-6 is the registry number for Chlorpyrifos Impurity 6. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Hydroxy-di(propan-2-yloxy)-sulfanylidene-lambda5-phosphane (CAS 4486-44-6) is a chemical compound with the molecular formula C6H15O3PS and a molecular weight of 198.22 g/mol. IUPAC name: hydroxy-di(propan-2-yloxy)-sulfanylidene-lambda5-phosphane. InChIKey: RPSWUJJTYUNDDU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H15O3PS
Molecular weight198.22 g/mol
IUPAC namehydroxy-di(propan-2-yloxy)-sulfanylidene-lambda5-phosphane
InChIKeyRPSWUJJTYUNDDU-UHFFFAOYSA-N
SMILESCC(C)OP(=S)(O)OC(C)C

Computed by PubChem (NCBI)