CAS 4497-59-0 is the registry number for 1-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)ethanone, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)ethanone (CAS 4497-59-0) is a chemical compound with the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. IUPAC name: 1-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)ethanone. InChIKey: DICCKTLYSLKYNN-UHFFFAOYSA-N.
| Molecular formula | C14H19NO |
|---|---|
| Molecular weight | 217.31 g/mol |
| IUPAC name | 1-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)ethanone |
| InChIKey | DICCKTLYSLKYNN-UHFFFAOYSA-N |
| SMILES | CC1CC(N(C2=CC=CC=C12)C(=O)C)(C)C |
Computed by PubChem (NCBI)